C11H13N3O5S — CID 63713883
(2S)-2-[(5-acetamidothiophene-2-carbonyl)amino]-4-amino-4-oxobutanoic acid (PubChem CID 63713883) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is (2S)-2-[(5-acetamidothiophene-2-carbonyl)amino]-4-amino-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(5-acetamidothiophene-2-carbonyl)amino]-4-amino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63713883 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2S)-2-[(5-acetamidothiophene-2-carbonyl)amino]-4-amino-4-oxobutanoic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)N[C@@H](CC(N)=O)C(=O)O)s1 |
| InChI | InChI=1S/C11H13N3O5S/c1-5(15)13-9-3-2-7(20-9)10(17)14-6(11(18)19)4-8(12)16/h2-3,6H,4H2,1H3,(H2,12,16)(H,13,15)(H,14,17)(H,18,19)/t6-/m0/s1 |
| InChIKey | OZVDDZSYLGHZFG-LURJTMIESA-N |
| XLogP | -0.24 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |