C23H24N2O2S — CID 24655748
5-acetamido-N-(1,4-diphenylbutyl)thiophene-2-carboxamide (PubChem CID 24655748) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 5-acetamido-N-(1,4-diphenylbutyl)thiophene-2-carboxamide.
| Compound Name | 5-acetamido-N-(1,4-diphenylbutyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24655748 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-acetamido-N-(1,4-diphenylbutyl)thiophene-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NC(CCCc2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C23H24N2O2S/c1-17(26)24-22-16-15-21(28-22)23(27)25-20(19-12-6-3-7-13-19)14-8-11-18-9-4-2-5-10-18/h2-7,9-10,12-13,15-16,20H,8,11,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | LONUJXRCHABQAY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |