C26H27N3O3 — CID 97003698
N-(4-carbamoyl-3-methylphenyl)-N'-[(1R)-1,4-diphenylbutyl]oxamide (PubChem CID 97003698) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-(4-carbamoyl-3-methylphenyl)-N'-[(1R)-1,4-diphenylbutyl]oxamide.
| Compound Name | N-(4-carbamoyl-3-methylphenyl)-N'-[(1R)-1,4-diphenylbutyl]oxamide |
|---|---|
| PubChem CID | 97003698 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-(4-carbamoyl-3-methylphenyl)-N'-[(1R)-1,4-diphenylbutyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)N[C@H](CCCc2ccccc2)c2ccccc2)ccc1C(N)=O |
| InChI | InChI=1S/C26H27N3O3/c1-18-17-21(15-16-22(18)24(27)30)28-25(31)26(32)29-23(20-12-6-3-7-13-20)14-8-11-19-9-4-2-5-10-19/h2-7,9-10,12-13,15-17,23H,8,11,14H2,1H3,(H2,27,30)(H,28,31)(H,29,32)/t23-/m1/s1 |
| InChIKey | BYPOAPJTTFSVQL-HSZRJFAPSA-N |
| XLogP | 3.91 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|