C23H22N6O2 — CID 6371525
1-phenyl-3-[(E)-[(3Z)-1-phenyl-3-(phenylcarbamoylhydrazinylidene)propylidene]amino]urea (PubChem CID 6371525) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 1-phenyl-3-[(E)-[(3Z)-1-phenyl-3-(phenylcarbamoylhydrazinylidene)propylidene]amino]urea.
| Compound Name | 1-phenyl-3-[(E)-[(3Z)-1-phenyl-3-(phenylcarbamoylhydrazinylidene)propylidene]amino]urea |
|---|---|
| PubChem CID | 6371525 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-phenyl-3-[(E)-[(3Z)-1-phenyl-3-(phenylcarbamoylhydrazinylidene)propylidene]amino]urea |
| SMILES | O=C(N/N=C\C/C(=N\NC(=O)Nc1ccccc1)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C23H22N6O2/c30-22(25-19-12-6-2-7-13-19)28-24-17-16-21(18-10-4-1-5-11-18)27-29-23(31)26-20-14-8-3-9-15-20/h1-15,17H,16H2,(H2,25,28,30)(H2,26,29,31)/b24-17-,27-21+ |
| InChIKey | ZVWJPALHQZGVDT-VSYQNHSQSA-N |
| XLogP | 4.41 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|