C17H16BrN3O3 — CID 9241838
(4Z)-4-(4-bromophenyl)-4-(phenylcarbamoylhydrazinylidene)butanoic acid (PubChem CID 9241838) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is (4Z)-4-(4-bromophenyl)-4-(phenylcarbamoylhydrazinylidene)butanoic acid.
| Compound Name | (4Z)-4-(4-bromophenyl)-4-(phenylcarbamoylhydrazinylidene)butanoic acid |
|---|---|
| PubChem CID | 9241838 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | (4Z)-4-(4-bromophenyl)-4-(phenylcarbamoylhydrazinylidene)butanoic acid |
| SMILES | O=C(O)CC/C(=N/NC(=O)Nc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrN3O3/c18-13-8-6-12(7-9-13)15(10-11-16(22)23)20-21-17(24)19-14-4-2-1-3-5-14/h1-9H,10-11H2,(H,22,23)(H2,19,21,24)/b20-15- |
| InChIKey | HFGOHFXTEHPVGI-HKWRFOASSA-N |
| XLogP | 3.84 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|