C17H15ClN3O3- — CID 7081380
(4Z)-4-[(3-chlorophenyl)carbamoylhydrazinylidene]-4-phenylbutanoate (PubChem CID 7081380) has the molecular formula C17H15ClN3O3- and a molecular weight of 344.78 g/mol. Its IUPAC name is (4Z)-4-[(3-chlorophenyl)carbamoylhydrazinylidene]-4-phenylbutanoate.
| Compound Name | (4Z)-4-[(3-chlorophenyl)carbamoylhydrazinylidene]-4-phenylbutanoate |
|---|---|
| PubChem CID | 7081380 |
| Molecular Formula | C17H15ClN3O3- |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4Z)-4-[(3-chlorophenyl)carbamoylhydrazinylidene]-4-phenylbutanoate |
| SMILES | O=C([O-])CC/C(=N/NC(=O)Nc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C17H16ClN3O3/c18-13-7-4-8-14(11-13)19-17(24)21-20-15(9-10-16(22)23)12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,22,23)(H2,19,21,24)/p-1/b20-15- |
| InChIKey | FEDTXGXAFMZPML-HKWRFOASSA-M |
| XLogP | 2.40 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|