C9H13N5O4 — CID 63717738
(2S)-4-amino-2-[(1-methylpyrazol-3-yl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 63717738) has the molecular formula C9H13N5O4 and a molecular weight of 255.23 g/mol. Its IUPAC name is (2S)-4-amino-2-[(1-methylpyrazol-3-yl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[(1-methylpyrazol-3-yl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63717738 |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (2S)-4-amino-2-[(1-methylpyrazol-3-yl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | Cn1ccc(NC(=O)N[C@@H](CC(N)=O)C(=O)O)n1 |
| InChI | InChI=1S/C9H13N5O4/c1-14-3-2-7(13-14)12-9(18)11-5(8(16)17)4-6(10)15/h2-3,5H,4H2,1H3,(H2,10,15)(H,16,17)(H2,11,12,13,18)/t5-/m0/s1 |
| InChIKey | HLHIUTHGNFXYPR-YFKPBYRVSA-N |
| XLogP | -1.13 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |