C15H22O3 — CID 637225
(1R,1aR,5R,7R,7aS,7bR)-5-hydroxy-1-(hydroxymethyl)-1,4,7-trimethyl-2,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[e]azulen-3-one (PubChem CID 637225) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,1aR,5R,7R,7aS,7bR)-5-hydroxy-1-(hydroxymethyl)-1,4,7-trimethyl-2,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[e]azulen-3-one.
| Compound Name | (1R,1aR,5R,7R,7aS,7bR)-5-hydroxy-1-(hydroxymethyl)-1,4,7-trimethyl-2,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[e]azulen-3-one |
|---|---|
| PubChem CID | 637225 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,1aR,5R,7R,7aS,7bR)-5-hydroxy-1-(hydroxymethyl)-1,4,7-trimethyl-2,5,6,7,7a,7b-hexahydro-1aH-cyclopropa[e]azulen-3-one |
| SMILES | CC1=C2[C@H]([C@H]3[C@@H](CC1=O)[C@@]3(C)CO)[C@H](C)C[C@H]2O |
| InChI | InChI=1S/C15H22O3/c1-7-4-11(18)13-8(2)10(17)5-9-14(12(7)13)15(9,3)6-16/h7,9,11-12,14,16,18H,4-6H2,1-3H3/t7-,9-,11-,12-,14-,15-/m1/s1 |
| InChIKey | YIEFDGFNXNISQJ-FEBFAIQHSA-N |
| XLogP | 1.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |