C13H17ClN4 — CID 63728481
3-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)-cyclopropylamino]propanenitrile (PubChem CID 63728481) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)-cyclopropylamino]propanenitrile.
| Compound Name | 3-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)-cyclopropylamino]propanenitrile |
|---|---|
| PubChem CID | 63728481 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[(6-chloro-5-propan-2-ylpyrimidin-4-yl)-cyclopropylamino]propanenitrile |
| SMILES | CC(C)c1c(Cl)ncnc1N(CCC#N)C1CC1 |
| InChI | InChI=1S/C13H17ClN4/c1-9(2)11-12(14)16-8-17-13(11)18(7-3-6-15)10-4-5-10/h8-10H,3-5,7H2,1-2H3 |
| InChIKey | XRXBXPRDNORNSO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |