C8H15N3O2S2 — CID 63736962
2-[2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]ethanol (PubChem CID 63736962) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]ethanol.
| Compound Name | 2-[2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 63736962 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-[2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]ethanol |
| SMILES | CN(C)c1nnc(SCCOCCO)s1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-11(2)7-9-10-8(15-7)14-6-5-13-4-3-12/h12H,3-6H2,1-2H3 |
| InChIKey | VWWUQAAEDLSOFM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|