C14H11ClN2O4 — CID 63745620
N-[(2-chloro-6-nitrophenyl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 63745620) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is N-[(2-chloro-6-nitrophenyl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[(2-chloro-6-nitrophenyl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 63745620 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-[(2-chloro-6-nitrophenyl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H11ClN2O4/c15-11-2-1-3-12(17(18)19)10(11)7-16-9-4-5-13-14(6-9)21-8-20-13/h1-6,16H,7-8H2 |
| InChIKey | LNTFJUVZPLWUDB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|