C12H22N4O2 — CID 63756508
1,3-dimethyl-5-[3-(propan-2-ylamino)propoxy]pyrazole-4-carboxamide (PubChem CID 63756508) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,3-dimethyl-5-[3-(propan-2-ylamino)propoxy]pyrazole-4-carboxamide.
| Compound Name | 1,3-dimethyl-5-[3-(propan-2-ylamino)propoxy]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63756508 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1,3-dimethyl-5-[3-(propan-2-ylamino)propoxy]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(OCCCNC(C)C)c1C(N)=O |
| InChI | InChI=1S/C12H22N4O2/c1-8(2)14-6-5-7-18-12-10(11(13)17)9(3)15-16(12)4/h8,14H,5-7H2,1-4H3,(H2,13,17) |
| InChIKey | PXAWKNUAIHSCKA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|