C14H17N3OS — CID 63763286
8-(6-amino-1,3-benzothiazol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 63763286) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 8-(6-amino-1,3-benzothiazol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-(6-amino-1,3-benzothiazol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 63763286 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 8-(6-amino-1,3-benzothiazol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | Nc1ccc2nc(N3C4CCC3CC(O)C4)sc2c1 |
| InChI | InChI=1S/C14H17N3OS/c15-8-1-4-12-13(5-8)19-14(16-12)17-9-2-3-10(17)7-11(18)6-9/h1,4-5,9-11,18H,2-3,6-7,15H2 |
| InChIKey | ZEHCPJRXGSXIHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|