C13H13N3O2S — CID 65298783
1-(6-amino-1,3-benzothiazol-2-yl)-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 65298783) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(6-amino-1,3-benzothiazol-2-yl)-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-(6-amino-1,3-benzothiazol-2-yl)-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 65298783 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(6-amino-1,3-benzothiazol-2-yl)-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(=O)N(c2nc3ccc(N)cc3s2)C1=O |
| InChI | InChI=1S/C13H13N3O2S/c1-13(2)6-10(17)16(11(13)18)12-15-8-4-3-7(14)5-9(8)19-12/h3-5H,6,14H2,1-2H3 |
| InChIKey | QNLBKPXHTNBSRJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|