C10H7N3OS2 — CID 59414095
2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazol-4-one (PubChem CID 59414095) has the molecular formula C10H7N3OS2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazol-4-one.
| Compound Name | 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 59414095 |
| Molecular Formula | C10H7N3OS2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-(6-amino-1,3-benzothiazol-2-yl)-1,3-thiazol-4-one |
| SMILES | Nc1ccc2nc(C3=NC(=O)CS3)sc2c1 |
| InChI | InChI=1S/C10H7N3OS2/c11-5-1-2-6-7(3-5)16-10(12-6)9-13-8(14)4-15-9/h1-3H,4,11H2 |
| InChIKey | VTLWYUBFWXWXRN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|