About 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol
8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 63769574) has the molecular formula C14H17N3O2S
and a molecular weight of 291.38 g/mol. Its IUPAC name is 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 63769574 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1CC2CCC(C1)N2Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C14H17N3O2S/c18-11-6-9-3-4-10(7-11)17(9)8-13-15-16-14(19-13)12-2-1-5-20-12/h1-2,5,9-11,18H,3-4,6-8H2 |
| InChIKey | FFTOVWYZDILRLL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol (CID 63769574) is 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol is OC1CC2CCC(C1)N2Cc1nnc(-c2cccs2)o1.
What is the InChIKey of 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol?
The InChIKey is FFTOVWYZDILRLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S/c18-11-6-9-3-4-10(7-11)17(9)8-13-15-16-14(19-13)12-2-1-5-20-12/h1-2,5,9-11,18H,3-4,6-8H2.
What are the key properties of 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol?
8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol has a molecular weight of 291.38 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 63769574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).