C9H5FN2O2 — CID 63773198
3-(3-fluorophenyl)-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 63773198) has the molecular formula C9H5FN2O2 and a molecular weight of 192.15 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-(3-fluorophenyl)-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63773198 |
| Molecular Formula | C9H5FN2O2 |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 3-(3-fluorophenyl)-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(-c2cccc(F)c2)no1 |
| InChI | InChI=1S/C9H5FN2O2/c10-7-3-1-2-6(4-7)9-11-8(5-13)14-12-9/h1-5H |
| InChIKey | BMSRUUDSPGPAAF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|