C15H12ClNO2S — CID 63796299
N-[(3-chlorophenyl)methyl]-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide (PubChem CID 63796299) has the molecular formula C15H12ClNO2S and a molecular weight of 305.79 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63796299 |
| Molecular Formula | C15H12ClNO2S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1sccc1C#CCO |
| InChI | InChI=1S/C15H12ClNO2S/c16-13-5-1-3-11(9-13)10-17-15(19)14-12(4-2-7-18)6-8-20-14/h1,3,5-6,8-9,18H,7,10H2,(H,17,19) |
| InChIKey | LYWFGKGNTPKZSX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|