C10H7N3O7 — CID 63799571
5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylic acid (PubChem CID 63799571) has the molecular formula C10H7N3O7 and a molecular weight of 281.18 g/mol. Its IUPAC name is 5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63799571 |
| Molecular Formula | C10H7N3O7 |
| Molecular Weight | 281.18 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-[(5-nitro-2,4-dioxopyrimidin-1-yl)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)o1 |
| InChI | InChI=1S/C10H7N3O7/c14-8-6(13(18)19)4-12(10(17)11-8)3-5-1-2-7(20-5)9(15)16/h1-2,4H,3H2,(H,15,16)(H,11,14,17) |
| InChIKey | UMFBNXIUNNULTM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.18 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|