C10H9ClN6O4 — CID 63799778
1-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-5-nitropyrimidine-2,4-dione (PubChem CID 63799778) has the molecular formula C10H9ClN6O4 and a molecular weight of 312.67 g/mol. Its IUPAC name is 1-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63799778 |
| Molecular Formula | C10H9ClN6O4 |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1-[(3-chloro-6-hydrazinyl-2-pyridinyl)methyl]-5-nitropyrimidine-2,4-dione |
| SMILES | NNc1ccc(Cl)c(Cn2cc([N+](=O)[O-])c(=O)[nH]c2=O)n1 |
| InChI | InChI=1S/C10H9ClN6O4/c11-5-1-2-8(15-12)13-6(5)3-16-4-7(17(20)21)9(18)14-10(16)19/h1-2,4H,3,12H2,(H,13,15)(H,14,18,19) |
| InChIKey | DUAJBUQELSVBNI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|