C6H14N2O2 — CID 6381340
(Z)-1,4-dimethoxybutan-2-ylidenehydrazine (PubChem CID 6381340) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (Z)-1,4-dimethoxybutan-2-ylidenehydrazine.
| Compound Name | (Z)-1,4-dimethoxybutan-2-ylidenehydrazine |
|---|---|
| PubChem CID | 6381340 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (Z)-1,4-dimethoxybutan-2-ylidenehydrazine |
| SMILES | COCC/C(COC)=N/N |
| InChI | InChI=1S/C6H14N2O2/c1-9-4-3-6(8-7)5-10-2/h3-5,7H2,1-2H3/b8-6- |
| InChIKey | BESPGLIJVBAZTP-VURMDHGXSA-N |
| XLogP | -0.02 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|