About (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine
(E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine (PubChem CID 5380761) has the molecular formula C12H24N2O4
and a molecular weight of 260.33 g/mol. Its IUPAC name is (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine.
Molecular Properties
| Compound Name | (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine |
| PubChem CID | 5380761 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine |
| SMILES | COCC/C(COC)=N/N=C(\CCOC)COC |
| InChI | InChI=1S/C12H24N2O4/c1-15-7-5-11(9-17-3)13-14-12(10-18-4)6-8-16-2/h5-10H2,1-4H3/b13-11-,14-12+ |
| InChIKey | XCWCLBRSXCSTQM-HEEUSZRZSA-N |
| XLogP | 1.15 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine?
The IUPAC name of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine (CID 5380761) is (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine.
What is the SMILES notation for (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine?
The canonical SMILES for (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine is COCC/C(COC)=N/N=C(\CCOC)COC.
What is the InChIKey of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine?
The InChIKey is XCWCLBRSXCSTQM-HEEUSZRZSA-N. The full InChI is InChI=1S/C12H24N2O4/c1-15-7-5-11(9-17-3)13-14-12(10-18-4)6-8-16-2/h5-10H2,1-4H3/b13-11-,14-12+.
What are the key properties of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine?
(E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine has a molecular weight of 260.33 g/mol, XLogP of 1.15, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1,4-dimethoxybutan-2-imine is sourced from PubChem (CID 5380761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).