About (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine
(E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine (PubChem CID 54602333) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine.
Molecular Properties
| Compound Name | (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine |
| PubChem CID | 54602333 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine |
| SMILES | CCCC/C(COC)=N\N=C(\CCOC)COC |
| InChI | InChI=1S/C13H26N2O3/c1-5-6-7-12(10-17-3)14-15-13(11-18-4)8-9-16-2/h5-11H2,1-4H3/b14-12+,15-13- |
| InChIKey | MPSCRMQJFKLNGL-GQJHWZHGSA-N |
| XLogP | 2.30 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine?
The IUPAC name of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine (CID 54602333) is (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine.
What is the SMILES notation for (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine?
The canonical SMILES for (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine is CCCC/C(COC)=N\N=C(\CCOC)COC.
What is the InChIKey of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine?
The InChIKey is MPSCRMQJFKLNGL-GQJHWZHGSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-5-6-7-12(10-17-3)14-15-13(11-18-4)8-9-16-2/h5-11H2,1-4H3/b14-12+,15-13-.
What are the key properties of (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine?
(E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine has a molecular weight of 258.36 g/mol, XLogP of 2.30, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(Z)-1,4-dimethoxybutan-2-ylideneamino]-1-methoxyhexan-2-imine is sourced from PubChem (CID 54602333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).