C16H23N3O2 — CID 63817513
1-[5-(2-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]propan-2-amine (PubChem CID 63817513) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[5-(2-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]propan-2-amine.
| Compound Name | 1-[5-(2-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 63817513 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[5-(2-ethoxyphenoxy)-1,3-dimethylpyrazol-4-yl]propan-2-amine |
| SMILES | CCOc1ccccc1Oc1c(CC(C)N)c(C)nn1C |
| InChI | InChI=1S/C16H23N3O2/c1-5-20-14-8-6-7-9-15(14)21-16-13(10-11(2)17)12(3)18-19(16)4/h6-9,11H,5,10,17H2,1-4H3 |
| InChIKey | PDFNKCGRYNZOCX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |