C19H18N4O2 — CID 6381961
[(E)-[2-[(E)-1-cyano-1-phenylprop-1-en-2-yl]oxy-1-phenylethylidene]amino]urea (PubChem CID 6381961) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is [(E)-[2-[(E)-1-cyano-1-phenylprop-1-en-2-yl]oxy-1-phenylethylidene]amino]urea.
| Compound Name | [(E)-[2-[(E)-1-cyano-1-phenylprop-1-en-2-yl]oxy-1-phenylethylidene]amino]urea |
|---|---|
| PubChem CID | 6381961 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(E)-[2-[(E)-1-cyano-1-phenylprop-1-en-2-yl]oxy-1-phenylethylidene]amino]urea |
| SMILES | C/C(OC/C(=N/NC(N)=O)c1ccccc1)=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C19H18N4O2/c1-14(17(12-20)15-8-4-2-5-9-15)25-13-18(22-23-19(21)24)16-10-6-3-7-11-16/h2-11H,13H2,1H3,(H3,21,23,24)/b17-14-,22-18- |
| InChIKey | DSFONTMHPQRKNF-DAWGKGOKSA-N |
| XLogP | 3.03 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|