C15H17N5OS — CID 912143
[[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]urea (PubChem CID 912143) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is [[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]urea.
| Compound Name | [[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]urea |
|---|---|
| PubChem CID | 912143 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [[2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-phenylethylidene]amino]urea |
| SMILES | Cc1cc(C)nc(SCC(=NNC(N)=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H17N5OS/c1-10-8-11(2)18-15(17-10)22-9-13(19-20-14(16)21)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H3,16,20,21) |
| InChIKey | CIBZLLBVYXADCM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|