C13H15N3O3S — CID 63820393
3-(benzenesulfonyl)-N-(5-methyl-1H-pyrazol-3-yl)propanamide (PubChem CID 63820393) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(5-methyl-1H-pyrazol-3-yl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(5-methyl-1H-pyrazol-3-yl)propanamide |
|---|---|
| PubChem CID | 63820393 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(5-methyl-1H-pyrazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCS(=O)(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C13H15N3O3S/c1-10-9-12(16-15-10)14-13(17)7-8-20(18,19)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,14,15,16,17) |
| InChIKey | QPJNCGUXMRYGFQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |