C9H12N4O2S — CID 63822247
1-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyrrole-3-sulfonamide (PubChem CID 63822247) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 1-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyrrole-3-sulfonamide.
| Compound Name | 1-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 63822247 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-methyl-N-(5-methyl-1H-pyrazol-3-yl)pyrrole-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccn(C)c2)n[nH]1 |
| InChI | InChI=1S/C9H12N4O2S/c1-7-5-9(11-10-7)12-16(14,15)8-3-4-13(2)6-8/h3-6H,1-2H3,(H2,10,11,12) |
| InChIKey | VVWIOARQPJHVBO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |