C13H11N3O4S — CID 63823163
N-(5-methyl-1H-pyrazol-3-yl)-2-oxochromene-6-sulfonamide (PubChem CID 63823163) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is N-(5-methyl-1H-pyrazol-3-yl)-2-oxochromene-6-sulfonamide.
| Compound Name | N-(5-methyl-1H-pyrazol-3-yl)-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 63823163 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-(5-methyl-1H-pyrazol-3-yl)-2-oxochromene-6-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc3oc(=O)ccc3c2)n[nH]1 |
| InChI | InChI=1S/C13H11N3O4S/c1-8-6-12(15-14-8)16-21(18,19)10-3-4-11-9(7-10)2-5-13(17)20-11/h2-7H,1H3,(H2,14,15,16) |
| InChIKey | JKAWZEOBHJNSNN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|