C12H17N3OS — CID 63825896
2-cyano-2-ethyl-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide (PubChem CID 63825896) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-cyano-2-ethyl-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide.
| Compound Name | 2-cyano-2-ethyl-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 63825896 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-cyano-2-ethyl-N-[2-(1,3-thiazol-4-yl)ethyl]butanamide |
| SMILES | CCC(C#N)(CC)C(=O)NCCc1cscn1 |
| InChI | InChI=1S/C12H17N3OS/c1-3-12(4-2,8-13)11(16)14-6-5-10-7-17-9-15-10/h7,9H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | OCLIGYABSSKRDA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |