C18H33NO — CID 63828343
N-(2-cyclohexyloxyethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine (PubChem CID 63828343) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is N-(2-cyclohexyloxyethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-(2-cyclohexyloxyethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 63828343 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | N-(2-cyclohexyloxyethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)C2CCC1(C)C(NCCOC1CCCCC1)C2 |
| InChI | InChI=1S/C18H33NO/c1-17(2)14-9-10-18(17,3)16(13-14)19-11-12-20-15-7-5-4-6-8-15/h14-16,19H,4-13H2,1-3H3 |
| InChIKey | IDDPLNUVZWOMBF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|