C16H31NO2 — CID 79927034
N-(2-cyclohexyloxyethyl)-2,2,5,5-tetramethyloxolan-3-amine (PubChem CID 79927034) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is N-(2-cyclohexyloxyethyl)-2,2,5,5-tetramethyloxolan-3-amine.
| Compound Name | N-(2-cyclohexyloxyethyl)-2,2,5,5-tetramethyloxolan-3-amine |
|---|---|
| PubChem CID | 79927034 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | N-(2-cyclohexyloxyethyl)-2,2,5,5-tetramethyloxolan-3-amine |
| SMILES | CC1(C)CC(NCCOC2CCCCC2)C(C)(C)O1 |
| InChI | InChI=1S/C16H31NO2/c1-15(2)12-14(16(3,4)19-15)17-10-11-18-13-8-6-5-7-9-13/h13-14,17H,5-12H2,1-4H3 |
| InChIKey | JFPWLHXLMMPGIK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|