C12H16N4O2S — CID 63830060
1,3-dimethyl-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyrimidine-2,4-dione (PubChem CID 63830060) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63830060 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1,3-dimethyl-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyrimidine-2,4-dione |
| SMILES | Cn1cc(CNCCc2cscn2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H16N4O2S/c1-15-6-9(11(17)16(2)12(15)18)5-13-4-3-10-7-19-8-14-10/h6-8,13H,3-5H2,1-2H3 |
| InChIKey | FPFHBCNKPJEFHS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|