C18H29Cl — CID 63833834
1-tert-butyl-4-(1-chloro-3,4,4-trimethylpentyl)benzene (PubChem CID 63833834) has the molecular formula C18H29Cl and a molecular weight of 280.88 g/mol. Its IUPAC name is 1-tert-butyl-4-(1-chloro-3,4,4-trimethylpentyl)benzene.
| Compound Name | 1-tert-butyl-4-(1-chloro-3,4,4-trimethylpentyl)benzene |
|---|---|
| PubChem CID | 63833834 |
| Molecular Formula | C18H29Cl |
| Molecular Weight | 280.88 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-tert-butyl-4-(1-chloro-3,4,4-trimethylpentyl)benzene |
| SMILES | CC(CC(Cl)c1ccc(C(C)(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C18H29Cl/c1-13(17(2,3)4)12-16(19)14-8-10-15(11-9-14)18(5,6)7/h8-11,13,16H,12H2,1-7H3 |
| InChIKey | PYQQPGHVAOBQIR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.88 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|