C10H11N5 — CID 63867593
4-ethyl-6-pyridin-2-yl-1,3,5-triazin-2-amine (PubChem CID 63867593) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-ethyl-6-pyridin-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-ethyl-6-pyridin-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63867593 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-ethyl-6-pyridin-2-yl-1,3,5-triazin-2-amine |
| SMILES | CCc1nc(N)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C10H11N5/c1-2-8-13-9(15-10(11)14-8)7-5-3-4-6-12-7/h3-6H,2H2,1H3,(H2,11,13,14,15) |
| InChIKey | ASCIPOXBMNUUPM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |