C12H24N2O3S — CID 63871035
4-(3-piperidin-4-yloxypropyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 63871035) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-(3-piperidin-4-yloxypropyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(3-piperidin-4-yloxypropyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 63871035 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-(3-piperidin-4-yloxypropyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(CCCOC2CCNCC2)CC1 |
| InChI | InChI=1S/C12H24N2O3S/c15-18(16)10-7-14(8-11-18)6-1-9-17-12-2-4-13-5-3-12/h12-13H,1-11H2 |
| InChIKey | UYIVOOOBUHBJMI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|