C12H22N2O — CID 65418148
4-[3-(2,5-dihydropyrrol-1-yl)propoxy]piperidine (PubChem CID 65418148) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-[3-(2,5-dihydropyrrol-1-yl)propoxy]piperidine.
| Compound Name | 4-[3-(2,5-dihydropyrrol-1-yl)propoxy]piperidine |
|---|---|
| PubChem CID | 65418148 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 4-[3-(2,5-dihydropyrrol-1-yl)propoxy]piperidine |
| SMILES | C1=CCN(CCCOC2CCNCC2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-2-9-14(8-1)10-3-11-15-12-4-6-13-7-5-12/h1-2,12-13H,3-11H2 |
| InChIKey | NQKVFLXHUUISPM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|