About 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane
7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane (PubChem CID 107456139) has the molecular formula C15H30N2OS
and a molecular weight of 286.49 g/mol. Its IUPAC name is 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane |
| PubChem CID | 107456139 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane |
| SMILES | CC1(C)CCN(CCCOC2CCNCC2)CCS1 |
| InChI | InChI=1S/C15H30N2OS/c1-15(2)6-10-17(11-13-19-15)9-3-12-18-14-4-7-16-8-5-14/h14,16H,3-13H2,1-2H3 |
| InChIKey | AGTCSPJRMKUQNT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane?
The IUPAC name of 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane (CID 107456139) is 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane.
What is the SMILES notation for 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane?
The canonical SMILES for 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane is CC1(C)CCN(CCCOC2CCNCC2)CCS1.
What is the InChIKey of 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane?
The InChIKey is AGTCSPJRMKUQNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2OS/c1-15(2)6-10-17(11-13-19-15)9-3-12-18-14-4-7-16-8-5-14/h14,16H,3-13H2,1-2H3.
What are the key properties of 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane?
7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane has a molecular weight of 286.49 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-4-(3-piperidin-4-yloxypropyl)-1,4-thiazepane is sourced from PubChem (CID 107456139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).