C11H15ClN2OS — CID 63891216
4-(2-amino-6-chlorophenyl)sulfanyl-N-methylbutanamide (PubChem CID 63891216) has the molecular formula C11H15ClN2OS and a molecular weight of 258.77 g/mol. Its IUPAC name is 4-(2-amino-6-chlorophenyl)sulfanyl-N-methylbutanamide.
| Compound Name | 4-(2-amino-6-chlorophenyl)sulfanyl-N-methylbutanamide |
|---|---|
| PubChem CID | 63891216 |
| Molecular Formula | C11H15ClN2OS |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-(2-amino-6-chlorophenyl)sulfanyl-N-methylbutanamide |
| SMILES | CNC(=O)CCCSc1c(N)cccc1Cl |
| InChI | InChI=1S/C11H15ClN2OS/c1-14-10(15)6-3-7-16-11-8(12)4-2-5-9(11)13/h2,4-5H,3,6-7,13H2,1H3,(H,14,15) |
| InChIKey | XFJMZFUILNBSNE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|