C14H15ClN2O3 — CID 63895802
1-(7-chloro-1,3-benzodioxol-5-yl)-2-(1-ethylpyrazol-4-yl)ethanol (PubChem CID 63895802) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 1-(7-chloro-1,3-benzodioxol-5-yl)-2-(1-ethylpyrazol-4-yl)ethanol.
| Compound Name | 1-(7-chloro-1,3-benzodioxol-5-yl)-2-(1-ethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 63895802 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-(7-chloro-1,3-benzodioxol-5-yl)-2-(1-ethylpyrazol-4-yl)ethanol |
| SMILES | CCn1cc(CC(O)c2cc(Cl)c3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C14H15ClN2O3/c1-2-17-7-9(6-16-17)3-12(18)10-4-11(15)14-13(5-10)19-8-20-14/h4-7,12,18H,2-3,8H2,1H3 |
| InChIKey | BZHPXMNOJHGKHV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |