C13H10ClNO3 — CID 63894459
(7-chloro-1,3-benzodioxol-5-yl)-pyridin-3-ylmethanol (PubChem CID 63894459) has the molecular formula C13H10ClNO3 and a molecular weight of 263.68 g/mol. Its IUPAC name is (7-chloro-1,3-benzodioxol-5-yl)-pyridin-3-ylmethanol.
| Compound Name | (7-chloro-1,3-benzodioxol-5-yl)-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 63894459 |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | (7-chloro-1,3-benzodioxol-5-yl)-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H10ClNO3/c14-10-4-9(5-11-13(10)18-7-17-11)12(16)8-2-1-3-15-6-8/h1-6,12,16H,7H2 |
| InChIKey | NPLGCOGNKZIHLY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |