C16H11ClO4 — CID 114723371
1-benzofuran-2-yl-(7-chloro-1,3-benzodioxol-5-yl)methanol (PubChem CID 114723371) has the molecular formula C16H11ClO4 and a molecular weight of 302.71 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(7-chloro-1,3-benzodioxol-5-yl)methanol.
| Compound Name | 1-benzofuran-2-yl-(7-chloro-1,3-benzodioxol-5-yl)methanol |
|---|---|
| PubChem CID | 114723371 |
| Molecular Formula | C16H11ClO4 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-benzofuran-2-yl-(7-chloro-1,3-benzodioxol-5-yl)methanol |
| SMILES | OC(c1cc(Cl)c2c(c1)OCO2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H11ClO4/c17-11-5-10(7-14-16(11)20-8-19-14)15(18)13-6-9-3-1-2-4-12(9)21-13/h1-7,15,18H,8H2 |
| InChIKey | QHZPINAOBYWPID-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |