C12H20N2O4 — CID 63897376
ethyl 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-oxobutanoate (PubChem CID 63897376) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 63897376 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | ethyl 4-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CN1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-4-18-10(16)7-9(15)8-14-6-5-13-11(17)12(14,2)3/h4-8H2,1-3H3,(H,13,17) |
| InChIKey | YZBCCUACOZWQQK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|