C7H13N4+ — CID 639037
5-[(E)-but-2-enyl]-1,4-dimethyltetrazol-1-ium (PubChem CID 639037) has the molecular formula C7H13N4+ and a molecular weight of 153.21 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-1,4-dimethyltetrazol-1-ium.
| Compound Name | 5-[(E)-but-2-enyl]-1,4-dimethyltetrazol-1-ium |
|---|---|
| PubChem CID | 639037 |
| Molecular Formula | C7H13N4+ |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | 5-[(E)-but-2-enyl]-1,4-dimethyltetrazol-1-ium |
| SMILES | C/C=C/Cc1n(C)nn[n+]1C |
| InChI | InChI=1S/C7H13N4/c1-4-5-6-7-10(2)8-9-11(7)3/h4-5H,6H2,1-3H3/q+1/b5-4+ |
| InChIKey | NOFMFASOQMTDKY-SNAWJCMRSA-N |
| XLogP | -0.24 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|