C10H19N4+ — CID 639035
5-[(E)-4,4-dimethylpent-2-enyl]-1,4-dimethyltetrazol-1-ium (PubChem CID 639035) has the molecular formula C10H19N4+ and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-[(E)-4,4-dimethylpent-2-enyl]-1,4-dimethyltetrazol-1-ium.
| Compound Name | 5-[(E)-4,4-dimethylpent-2-enyl]-1,4-dimethyltetrazol-1-ium |
|---|---|
| PubChem CID | 639035 |
| Molecular Formula | C10H19N4+ |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 5-[(E)-4,4-dimethylpent-2-enyl]-1,4-dimethyltetrazol-1-ium |
| SMILES | Cn1nn[n+](C)c1C/C=C/C(C)(C)C |
| InChI | InChI=1S/C10H19N4/c1-10(2,3)8-6-7-9-13(4)11-12-14(9)5/h6,8H,7H2,1-5H3/q+1/b8-6+ |
| InChIKey | JATLTEHLMNHJEJ-SOFGYWHQSA-N |
| XLogP | 0.78 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|