C6H11N4+ — CID 639034
1,4-dimethyl-5-prop-2-enyltetrazol-1-ium (PubChem CID 639034) has the molecular formula C6H11N4+ and a molecular weight of 139.18 g/mol. Its IUPAC name is 1,4-dimethyl-5-prop-2-enyltetrazol-1-ium.
| Compound Name | 1,4-dimethyl-5-prop-2-enyltetrazol-1-ium |
|---|---|
| PubChem CID | 639034 |
| Molecular Formula | C6H11N4+ |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1,4-dimethyl-5-prop-2-enyltetrazol-1-ium |
| SMILES | C=CCc1n(C)nn[n+]1C |
| InChI | InChI=1S/C6H11N4/c1-4-5-6-9(2)7-8-10(6)3/h4H,1,5H2,2-3H3/q+1 |
| InChIKey | JPGLGPNXCISAAT-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|