C7H10N4 — CID 123291251
1-methyl-5-penta-1,3-dien-3-yltetrazole (PubChem CID 123291251) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-methyl-5-penta-1,3-dien-3-yltetrazole.
| Compound Name | 1-methyl-5-penta-1,3-dien-3-yltetrazole |
|---|---|
| PubChem CID | 123291251 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-methyl-5-penta-1,3-dien-3-yltetrazole |
| SMILES | C=CC(=CC)c1nnnn1C |
| InChI | InChI=1S/C7H10N4/c1-4-6(5-2)7-8-9-10-11(7)3/h4-5H,1H2,2-3H3 |
| InChIKey | RAFBFMHZXKOWDL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|