C8H10N4 — CID 22351201
5-cyclohexa-1,5-dien-1-yl-1-methyltetrazole (PubChem CID 22351201) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-1-methyltetrazole.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-1-methyltetrazole |
|---|---|
| PubChem CID | 22351201 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-1-methyltetrazole |
| SMILES | Cn1nnnc1C1=CCCC=C1 |
| InChI | InChI=1S/C8H10N4/c1-12-8(9-10-11-12)7-5-3-2-4-6-7/h3,5-6H,2,4H2,1H3 |
| InChIKey | DCRBMPDOSLDCJR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |