C12H15N3O2S — CID 63903829
4-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide (PubChem CID 63903829) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide.
| Compound Name | 4-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 63903829 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]oxane-4-carboxamide |
| SMILES | CC(NC(=O)C1(C#N)CCOCC1)c1nccs1 |
| InChI | InChI=1S/C12H15N3O2S/c1-9(10-14-4-7-18-10)15-11(16)12(8-13)2-5-17-6-3-12/h4,7,9H,2-3,5-6H2,1H3,(H,15,16) |
| InChIKey | DXDYQYYFAASNDM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |