C13H16F2N2O3S — CID 63922156
N-(2,6-difluorophenyl)-2-[(1,1-dioxothian-3-yl)amino]acetamide (PubChem CID 63922156) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.34 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[(1,1-dioxothian-3-yl)amino]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[(1,1-dioxothian-3-yl)amino]acetamide |
|---|---|
| PubChem CID | 63922156 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[(1,1-dioxothian-3-yl)amino]acetamide |
| SMILES | O=C(CNC1CCCS(=O)(=O)C1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2N2O3S/c14-10-4-1-5-11(15)13(10)17-12(18)7-16-9-3-2-6-21(19,20)8-9/h1,4-5,9,16H,2-3,6-8H2,(H,17,18) |
| InChIKey | IABAZXQQFCXNKG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |